EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757066 - fosmanogepix
| Formula | C22H21N4O6P |
| Net Charge | 0 |
| Average Mass | 468.406 |
| Monoisotopic Mass | 468.11987 |
| SMILES | Nc1c(-c2cc(Cc3ccc(COc4ccccn4)cc3)no2)ccc[n+]1COP(=O)([O-])O |
| InChI | InChI=1S/C22H21N4O6P/c23-22-19(4-3-11-26(22)15-31-33(27,28)29)20-13-18(25-32-20)12-16-6-8-17(9-7-16)14-30-21-5-1-2-10-24-21/h1-11,13,23H,12,14-15H2,(H2,27,28,29) |
| InChIKey | JQONJQKKVAHONF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosmanogepix (CHEBI:757066) has role antifungal agent (CHEBI:35718) |
| fosmanogepix (CHEBI:757066) has role antifungal drug (CHEBI:86327) |
| fosmanogepix (CHEBI:757066) has role antineoplastic agent (CHEBI:35610) |
| fosmanogepix (CHEBI:757066) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| fosmanogepix | WHO MedNet |
| Synonyms | Source |
|---|---|
| Apx-001 | ChEMBL |
| APX001 | ChEMBL |
| E1211 | ChEMBL |
| Citations |
|---|