EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23ClN6O2 |
| Net Charge | 0 |
| Average Mass | 450.930 |
| Monoisotopic Mass | 450.15710 |
| SMILES | COc1ccc(-n2nccn2)c(C(=O)N2CCC[C@@]2(C)c2nc3ccc(Cl)c(C)c3n2)c1 |
| InChI | InChI=1S/C23H23ClN6O2/c1-14-17(24)6-7-18-20(14)28-22(27-18)23(2)9-4-12-29(23)21(31)16-13-15(32-3)5-8-19(16)30-25-10-11-26-30/h5-8,10-11,13H,4,9,12H2,1-3H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | NBGABHGMJVIVBW-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daridorexant (CHEBI:757065) has role antidepressant (CHEBI:35469) |
| daridorexant (CHEBI:757065) is a triazoles (CHEBI:35727) |
| INN | Source |
|---|---|
| nemorexant | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACT-541468 | ChEMBL |
| Daridorexant | ChEMBL |
| DEA NO. 2410 | ChEMBL |
| Citations |
|---|