EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26FN5O3 |
| Net Charge | 0 |
| Average Mass | 439.491 |
| Monoisotopic Mass | 439.20197 |
| SMILES | Cc1nc(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)N[C@H]1CCN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C23H26FN5O3/c1-12-19(10-17-16-9-14(24)5-6-18(16)27-21(17)30)25-13(2)20(12)22(31)26-15-7-8-29(11-15)23(32)28(3)4/h5-6,9-10,15,25H,7-8,11H2,1-4H3,(H,26,31)(H,27,30)/b17-10-/t15-/m0/s1 |
| InChIKey | KMIOJWCYOHBUJS-HAKPAVFJSA-N |
| Roles Classification |
|---|
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vorolanib (CHEBI:757062) has role antineoplastic agent (CHEBI:35610) |
| vorolanib (CHEBI:757062) has role ophthalmology drug (CHEBI:66981) |
| vorolanib (CHEBI:757062) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| vorolanib | WHO MedNet |
| Citations |
|---|