EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16F3N5O4S |
| Net Charge | 0 |
| Average Mass | 419.385 |
| Monoisotopic Mass | 419.08751 |
| SMILES | CN(CC(=O)Nc1nc2ccc(OC(F)(F)F)cc2s1)C(=O)CNC(=O)CN |
| InChI | InChI=1S/C15H16F3N5O4S/c1-23(13(26)6-20-11(24)5-19)7-12(25)22-14-21-9-3-2-8(4-10(9)28-14)27-15(16,17)18/h2-4H,5-7,19H2,1H3,(H,20,24)(H,21,22,25) |
| InChIKey | YBZSGIWIPOUSHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| troriluzole (CHEBI:757061) has role antineoplastic agent (CHEBI:35610) |
| troriluzole (CHEBI:757061) has role anxiolytic drug (CHEBI:35474) |
| troriluzole (CHEBI:757061) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| BHV-4157a | ChEMBL |
| Trigriluzole | ChEMBL |
| Troriluzole | ChEMBL |