EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H18FN5O2 |
| Net Charge | 0 |
| Average Mass | 415.428 |
| Monoisotopic Mass | 415.14445 |
| SMILES | CC[C@H](Nc1ncnc2ncnc12)c1oc2ccccc2c(=O)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C23H18FN5O2/c1-2-16(29-23-19-22(26-11-25-19)27-12-28-23)21-18(13-6-5-7-14(24)10-13)20(30)15-8-3-4-9-17(15)31-21/h3-12,16H,2H2,1H3,(H2,25,26,27,28,29)/t16-/m0/s1 |
| InChIKey | HDXDQPRPFRKGKZ-INIZCTEOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenalisib (CHEBI:757059) has role antineoplastic agent (CHEBI:35610) |
| tenalisib (CHEBI:757059) is a isoflavones (CHEBI:38757) |
| INN | Source |
|---|---|
| tenalisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Rp-6530 | ChEMBL |
| RP6530 | ChEMBL |
| Citations |
|---|