EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757058 - tegoprazan
| Formula | C20H19F2N3O3 |
| Net Charge | 0 |
| Average Mass | 387.386 |
| Monoisotopic Mass | 387.13945 |
| SMILES | Cc1nc2cc(C(=O)N(C)C)cc(O[C@H]3CCOc4cc(F)cc(F)c43)c2n1 |
| InChI | InChI=1S/C20H19F2N3O3/c1-10-23-14-6-11(20(26)25(2)3)7-17(19(14)24-10)28-15-4-5-27-16-9-12(21)8-13(22)18(15)16/h6-9,15H,4-5H2,1-3H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | CLIQCDHNPDMGSL-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tegoprazan (CHEBI:757058) has role anti-ulcer drug (CHEBI:49201) |
| tegoprazan (CHEBI:757058) has role antibacterial agent (CHEBI:33282) |
| tegoprazan (CHEBI:757058) is a 1-benzopyran (CHEBI:38443) |
| Synonyms | Source |
|---|---|
| Cj-12420 | ChEMBL |
| LXI-15028 | ChEMBL |
| Tegoprazan | ChEMBL |
| Citations |
|---|