EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757057 - tefinostat
| Formula | C28H37N3O5 |
| Net Charge | 0 |
| Average Mass | 495.620 |
| Monoisotopic Mass | 495.27332 |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(CN[C@H](C(=O)OC2CCCC2)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C28H37N3O5/c32-25(14-6-1-2-7-15-26(33)31-35)30-23-18-16-21(17-19-23)20-29-27(22-10-4-3-5-11-22)28(34)36-24-12-8-9-13-24/h3-5,10-11,16-19,24,27,29,35H,1-2,6-9,12-15,20H2,(H,30,32)(H,31,33)/t27-/m0/s1 |
| InChIKey | GLNWREBYRLDPQP-MHZLTWQESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tefinostat (CHEBI:757057) has role antineoplastic agent (CHEBI:35610) |
| tefinostat (CHEBI:757057) is a α-amino acid ester (CHEBI:46874) |
| INN | Source |
|---|---|
| tefinostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chr-2845 | ChEMBL |
| CHR2845 | ChEMBL |