EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H21F3N8O |
| Net Charge | 0 |
| Average Mass | 530.514 |
| Monoisotopic Mass | 530.17904 |
| SMILES | Cc1cn(-c2cc(NC(=O)c3ccc(C)c(Nc4nccc(-c5cnccn5)n4)c3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C27H21F3N8O/c1-16-3-4-18(9-23(16)37-26-33-6-5-22(36-26)24-13-31-7-8-32-24)25(39)35-20-10-19(27(28,29)30)11-21(12-20)38-14-17(2)34-15-38/h3-15H,1-2H3,(H,35,39)(H,33,36,37) |
| InChIKey | DUPWHXBITIZIKZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| radotinib (CHEBI:757004) has role antineoplastic agent (CHEBI:35610) |
| radotinib (CHEBI:757004) has role antiparkinson drug (CHEBI:48407) |
| radotinib (CHEBI:757004) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| radotinib | WHO MedNet |
| Synonym | Source |
|---|---|
| IY5511 | ChEMBL |
| Citations |
|---|