EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27F2N5O4 |
| Net Charge | 0 |
| Average Mass | 487.507 |
| Monoisotopic Mass | 487.20311 |
| SMILES | CCN1C(=O)N(c2c(F)c(OC)cc(OC)c2F)Cc2cnc3nc(CN4CCOCC4)cc3c21 |
| InChI | InChI=1S/C24H27F2N5O4/c1-4-30-21-14(11-27-23-16(21)9-15(28-23)13-29-5-7-35-8-6-29)12-31(24(30)32)22-19(25)17(33-2)10-18(34-3)20(22)26/h9-11H,4-8,12-13H2,1-3H3,(H,27,28) |
| InChIKey | HCDMJFOHIXMBOV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pemigatinib (CHEBI:757002) has role antineoplastic agent (CHEBI:35610) |
| pemigatinib (CHEBI:757002) is a dimethoxybenzene (CHEBI:51681) |
| Synonyms | Source |
|---|---|
| Fgfr inhibitor incb054828 | ChEMBL |
| Incb-054828 | ChEMBL |
| INCB054828 | ChEMBL |
| Pemigatinib | ChEMBL |
| Brand Name | Source |
|---|---|
| Pemazyre | ChEMBL |
| Citations |
|---|