EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H62N6O11S |
| Net Charge | 0 |
| Average Mass | 859.056 |
| Monoisotopic Mass | 858.41973 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](C)C(=O)[C@@H](C)C(=O)O[C@H](CC)[C@@]3(C)OC(=O)[C@@H](/C(N)=N/O[C@@H](C)c4nnc(-c5ccccn5)s4)[C@]3([H])[C@@H](C)C(=O)[C@H](C)C[C@@]2(C)OC)O[C@H](C)C[C@H](N(C)C)[C@H]1O |
| InChI | InChI=1S/C42H62N6O11S/c1-13-28-42(9)30(29(39(53)58-42)35(43)47-59-25(7)36-45-46-37(60-36)26-16-14-15-17-44-26)22(4)31(49)20(2)19-41(8,54-12)34(23(5)32(50)24(6)38(52)56-28)57-40-33(51)27(48(10)11)18-21(3)55-40/h14-17,20-25,27-30,33-34,40,51H,13,18-19H2,1-12H3,(H2,43,47)/t20-,21-,22-,23+,24-,25+,27+,28-,29-,30+,33-,34-,40+,41-,42-/m1/s1 |
| InChIKey | RLFCSBSRGRJFRO-QAOQTAGDSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nafithromycin (CHEBI:756999) has role antibacterial agent (CHEBI:33282) |
| nafithromycin (CHEBI:756999) is a organohalogen compound (CHEBI:17792) |
| nafithromycin (CHEBI:756999) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| nafithromycin | WHO MedNet |
| nafithromycine | WHO MedNet |
| nafitromicina | WHO MedNet |
| Synonym | Source |
|---|---|
| WCK-4873 | ChEMBL |