EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756998 - mavacamten
| Formula | C15H19N3O2 |
| Net Charge | 0 |
| Average Mass | 273.336 |
| Monoisotopic Mass | 273.14773 |
| SMILES | CC(C)n1c(=O)cc(N[C@@H](C)c2ccccc2)nc1=O |
| InChI | InChI=1S/C15H19N3O2/c1-10(2)18-14(19)9-13(17-15(18)20)16-11(3)12-7-5-4-6-8-12/h4-11,16H,1-3H3,(H,17,20)/t11-/m0/s1 |
| InChIKey | RLCLASQCAPXVLM-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mavacamten (CHEBI:756998) has role cardiovascular drug (CHEBI:35554) |
| mavacamten (CHEBI:756998) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| Synonyms | Source |
|---|---|
| Camzyos | ChEMBL |
| Mavacamten | ChEMBL |
| MYK-461 | ChEMBL |
| SAR-439152 | ChEMBL |
| Citations |
|---|