EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H20N2O6S4 |
| Net Charge | 0 |
| Average Mass | 368.524 |
| Monoisotopic Mass | 368.02042 |
| SMILES | N[C@@H](CCS(=O)(=O)O)CSSC[C@@H](N)CCS(=O)(=O)O |
| InChI | InChI=1S/C8H20N2O6S4/c9-7(1-3-19(11,12)13)5-17-18-6-8(10)2-4-20(14,15)16/h7-8H,1-6,9-10H2,(H,11,12,13)(H,14,15,16)/t7-,8-/m0/s1 |
| InChIKey | HJPXZXVKLGEMGP-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| firibastat (CHEBI:756993) has role antihypertensive agent (CHEBI:35674) |
| firibastat (CHEBI:756993) has role cardiovascular drug (CHEBI:35554) |
| firibastat (CHEBI:756993) is a organosulfonic acid (CHEBI:33551) |
| INN | Source |
|---|---|
| firibastat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Qgc-001 | ChEMBL |
| QGC001 | ChEMBL |
| RB-150 | ChEMBL |