EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N3O5 |
| Net Charge | 0 |
| Average Mass | 453.539 |
| Monoisotopic Mass | 453.22637 |
| SMILES | CCc1cc(-c2noc(-c3cc(OC)nc(C4CCCC4)c3)n2)cc(C)c1OC[C@@H](O)CO |
| InChI | InChI=1S/C25H31N3O5/c1-4-16-10-18(9-15(2)23(16)32-14-20(30)13-29)24-27-25(33-28-24)19-11-21(17-7-5-6-8-17)26-22(12-19)31-3/h9-12,17,20,29-30H,4-8,13-14H2,1-3H3/t20-/m0/s1 |
| InChIKey | KJKKMMMRWISKRF-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cenerimod (CHEBI:756990) has role renoprotective agent (CHEBI:231911) |
| cenerimod (CHEBI:756990) is a oxadiazole (CHEBI:46685) |
| cenerimod (CHEBI:756990) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| cenerimod | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACT-334441 | ChEMBL |
| ACT334441 | ChEMBL |
| Citations |
|---|