EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H23F2N3O7S |
| Net Charge | 0 |
| Average Mass | 571.558 |
| Monoisotopic Mass | 571.12248 |
| SMILES | [H][C@@]12COCCN1C(=O)c1c(OCOC(=O)OC)c(=O)ccn1N2[C@@H]1c2ccccc2SCc2c1ccc(F)c2F |
| InChI | InChI=1S/C27H23F2N3O7S/c1-36-27(35)39-14-38-25-19(33)8-9-31-24(25)26(34)30-10-11-37-12-21(30)32(31)23-15-6-7-18(28)22(29)17(15)13-40-20-5-3-2-4-16(20)23/h2-9,21,23H,10-14H2,1H3/t21-,23+/m1/s1 |
| InChIKey | RZVPBGBYGMDSBG-GGAORHGYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| baloxavir marboxil (CHEBI:756989) has role antimicrobial agent (CHEBI:33281) |
| baloxavir marboxil (CHEBI:756989) has role antiviral agent (CHEBI:22587) |
| baloxavir marboxil (CHEBI:756989) is a dibenzothiepine (CHEBI:38924) |
| Synonyms | Source |
|---|---|
| Baloxavir marboxil | ChEMBL |
| S-033188 | ChEMBL |
| Brand Name | Source |
|---|---|
| Xofluza | ChEMBL |
| Citations |
|---|