EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N3O7P |
| Net Charge | 0 |
| Average Mass | 485.433 |
| Monoisotopic Mass | 485.13519 |
| SMILES | Cc1c(CN(C)C(=O)/C=C/c2cnc3c(c2)CCC(=O)N3COP(=O)(O)O)oc2ccccc12 |
| InChI | InChI=1S/C23H24N3O7P/c1-15-18-5-3-4-6-19(18)33-20(15)13-25(2)21(27)9-7-16-11-17-8-10-22(28)26(23(17)24-12-16)14-32-34(29,30)31/h3-7,9,11-12H,8,10,13-14H2,1-2H3,(H2,29,30,31)/b9-7+ |
| InChIKey | HFYMDQMXVPJNTH-VQHVLOKHSA-N |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afabicin (CHEBI:756987) has role antiinfective agent (CHEBI:35441) |
| afabicin (CHEBI:756987) is a naphthyridine derivative (CHEBI:73539) |
| INNs | Source |
|---|---|
| afabicin | WHO MedNet |
| afabicina | WHO MedNet |
| afabicine | WHO MedNet |
| Synonyms | Source |
|---|---|
| AFN-1720 | ChEMBL |
| AFN1720 | ChEMBL |
| DEBIO-1450 | ChEMBL |
| DEBIO1450 | ChEMBL |
| Citations |
|---|