EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H47NO2 |
| Net Charge | 0 |
| Average Mass | 405.667 |
| Monoisotopic Mass | 405.36068 |
| SMILES | [H][C@@]12CC/C(=N\O)[C@](C)(CCCO)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C26H47NO2/c1-18(2)8-6-9-19(3)21-11-12-22-20-10-13-24(27-29)26(5,15-7-17-28)23(20)14-16-25(21,22)4/h18-23,28-29H,6-17H2,1-5H3/b27-24+/t19-,20+,21-,22+,23+,25-,26-/m1/s1 |
| InChIKey | OBKBVSFXEIFOMS-YVABUZGXSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tro-40303 (CHEBI:756986) has role cardiovascular drug (CHEBI:35554) |
| tro-40303 (CHEBI:756986) is a sesquiterpenoid (CHEBI:26658) |
| Synonyms | Source |
|---|---|
| TRO 40303 | ChEMBL |
| TRO-40303 | ChEMBL |
| TRO40303 | ChEMBL |