EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22F4N4O |
| Net Charge | 0 |
| Average Mass | 446.448 |
| Monoisotopic Mass | 446.17297 |
| SMILES | NCc1ccc2c(c1)nc(CN1C(=O)C3(CC3)c3ccc(F)cc31)n2CCCC(F)(F)F |
| InChI | InChI=1S/C23H22F4N4O/c24-15-3-4-16-19(11-15)31(21(32)22(16)7-8-22)13-20-29-17-10-14(12-28)2-5-18(17)30(20)9-1-6-23(25,26)27/h2-5,10-11H,1,6-9,12-13,28H2 |
| InChIKey | JOPCJJSYRPUEDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sisunatovir (CHEBI:756983) has role antiviral agent (CHEBI:22587) |
| sisunatovir (CHEBI:756983) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| sisunatovir | WHO MedNet |
| Synonyms | Source |
|---|---|
| Pf-07923568 | ChEMBL |
| RV-521 | ChEMBL |
| RV521 | ChEMBL |
| Citations |
|---|