EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H48FN9O4 |
| Net Charge | 0 |
| Average Mass | 725.870 |
| Monoisotopic Mass | 725.38133 |
| SMILES | [H][C@]12CN(Cc3cccc(N4CC(N5CCN(CC)CC5)C4)n3)C(=O)[C@H](Cc3ccc(O)cc3F)N1C(=O)CN(CC=C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C39H48FN9O4/c1-3-15-47-27-37(51)48-34(20-29-13-14-32(50)21-33(29)40)38(52)46(26-36(48)49(47)39(53)41-22-28-9-6-5-7-10-28)23-30-11-8-12-35(42-30)45-24-31(25-45)44-18-16-43(4-2)17-19-44/h3,5-14,21,31,34,36,50H,1,4,15-20,22-27H2,2H3,(H,41,53)/t34-,36-/m0/s1 |
| InChIKey | ZGNKNLOBYFTGRG-GIWKVKTRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| e-7386 (CHEBI:756977) has role antineoplastic agent (CHEBI:35610) |
| e-7386 (CHEBI:756977) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| E 7386 | ChEMBL |
| E-7386 | ChEMBL |
| E7386 | ChEMBL |