EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C67H122N12O13 |
| Net Charge | 0 |
| Average Mass | 1303.784 |
| Monoisotopic Mass | 1302.92543 |
| SMILES | [H][C@]1([C@H](O)[C@H](C)CCCCCCNC(C)=O)C(=O)N[C@@H](CC)C(=O)N(C)[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C67H122N12O13/c1-26-48-63(88)73(19)46(17)62(87)74(20)50(34-38(4)5)59(84)72-53(41(10)11)66(91)75(21)49(33-37(2)3)58(83)69-44(15)57(82)70-45(16)61(86)76(22)51(35-39(6)7)64(89)77(23)52(36-40(8)9)65(90)78(24)54(42(12)13)67(92)79(25)55(60(85)71-48)56(81)43(14)31-29-27-28-30-32-68-47(18)80/h37-46,48-56,81H,26-36H2,1-25H3,(H,68,80)(H,69,83)(H,70,82)(H,71,85)(H,72,84)/t43-,44+,45-,46-,48+,49+,50+,51+,52+,53+,54+,55+,56-/m1/s1 |
| InChIKey | KBARHGHBFILILC-NGIJKBHDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rencofilstat (CHEBI:756973) has role antineoplastic agent (CHEBI:35610) |
| rencofilstat (CHEBI:756973) is a homodetic cyclic peptide (CHEBI:24613) |
| INN | Source |
|---|---|
| rencofilstat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cpi-431 | ChEMBL |
| Cpi-431-32 | ChEMBL |
| CRV-431 | ChEMBL |
| CRV431 | ChEMBL |