EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13ClN4O |
| Net Charge | 0 |
| Average Mass | 288.738 |
| Monoisotopic Mass | 288.07779 |
| SMILES | Cc1ccncc1N1CCN(c2ccnc(Cl)c2)C1=O |
| InChI | InChI=1S/C14H13ClN4O/c1-10-2-4-16-9-12(10)19-7-6-18(14(19)20)11-3-5-17-13(15)8-11/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | ZVIFCOOHWGNPHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cfg-920 (CHEBI:756971) has role antineoplastic agent (CHEBI:35610) |
| cfg-920 (CHEBI:756971) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| CFG-920 | ChEMBL |
| CFG920 | ChEMBL |
| Lae 001 | ChEMBL |
| LAE-001 | ChEMBL |
| LAE001 | ChEMBL |