EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756964 - vamotinib
| Formula | C29H27F3N6O |
| Net Charge | 0 |
| Average Mass | 532.570 |
| Monoisotopic Mass | 532.21984 |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1nnc2ccccn12 |
| InChI | InChI=1S/C29H27F3N6O/c1-20-6-7-22(17-21(20)9-11-27-35-34-26-5-3-4-12-38(26)27)28(39)33-24-10-8-23(25(18-24)29(30,31)32)19-37-15-13-36(2)14-16-37/h3-8,10,12,17-18H,13-16,19H2,1-2H3,(H,33,39) |
| InChIKey | SLIVDYMORZGPLW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vamotinib (CHEBI:756964) has role antineoplastic agent (CHEBI:35610) |
| vamotinib (CHEBI:756964) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| vamotinib | WHO MedNet |
| Synonym | Source |
|---|---|
| PF-114 | ChEMBL |
| Citations |
|---|