EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N4O6P |
| Net Charge | 0 |
| Average Mass | 460.427 |
| Monoisotopic Mass | 460.15117 |
| SMILES | C[C@@H](OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2cccc(C(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C21H25N4O6P/c1-15(31-32(29,23-9-10-23)24-11-12-24)16-7-8-19(25(27)28)20(14-16)30-18-6-4-5-17(13-18)21(26)22(2)3/h4-8,13-15H,9-12H2,1-3H3/t15-/m1/s1 |
| InChIKey | NWGZZGNICQFUHV-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obi-3424 (CHEBI:756960) has role antineoplastic agent (CHEBI:35610) |
| obi-3424 (CHEBI:756960) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| AST-3424 | ChEMBL |
| Obi 3424 | ChEMBL |
| OBI-3424 | ChEMBL |
| OBI3424 | ChEMBL |
| TH-3424 | ChEMBL |