EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16F3N3O2 |
| Net Charge | 0 |
| Average Mass | 399.372 |
| Monoisotopic Mass | 399.11946 |
| SMILES | Cc1occc1C(=O)Nc1nn(Cc2ccc(C(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H16F3N3O2/c1-13-16(10-11-29-13)20(28)25-19-17-4-2-3-5-18(17)27(26-19)12-14-6-8-15(9-7-14)21(22,23)24/h2-11H,12H2,1H3,(H,25,26,28) |
| InChIKey | XLLRLAABUFOJPC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| np-g2-044 (CHEBI:756959) has role antineoplastic agent (CHEBI:35610) |
| np-g2-044 (CHEBI:756959) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| Synonym | Source |
|---|---|
| NP-G2-044 | ChEMBL |