EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23FN6OS |
| Net Charge | 0 |
| Average Mass | 438.532 |
| Monoisotopic Mass | 438.16381 |
| SMILES | COc1cc(F)ccc1-c1c(C)sc2cnc(Nc3cnn(C4CCNCC4)c3)nc12 |
| InChI | InChI=1S/C22H23FN6OS/c1-13-20(17-4-3-14(23)9-18(17)30-2)21-19(31-13)11-25-22(28-21)27-15-10-26-29(12-15)16-5-7-24-8-6-16/h3-4,9-12,16,24H,5-8H2,1-2H3,(H,25,27,28) |
| InChIKey | AVIOBQFPAGEICQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nefextinib (CHEBI:756956) has role antineoplastic agent (CHEBI:35610) |
| nefextinib (CHEBI:756956) is a organic heterobicyclic compound (CHEBI:27171) |
| nefextinib (CHEBI:756956) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| nefextinib (CHEBI:756956) is a organosulfur heterocyclic compound (CHEBI:38106) |
| INN | Source |
|---|---|
| nefextinib | WHO MedNet |
| Synonym | Source |
|---|---|
| MAX-40279 | ChEMBL |