EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756954 - zetomipzomib
| Formula | C30H42N4O8 |
| Net Charge | 0 |
| Average Mass | 586.686 |
| Monoisotopic Mass | 586.30026 |
| SMILES | COc1ccc([C@@H](O)[C@H](NC(=O)[C@H](C)NC(=O)CN2CCOCC2)C(=O)N[C@@H](CC2=CCCC2)C(=O)[C@@]2(C)CO2)cc1 |
| InChI | InChI=1S/C30H42N4O8/c1-19(31-24(35)17-34-12-14-41-15-13-34)28(38)33-25(26(36)21-8-10-22(40-3)11-9-21)29(39)32-23(16-20-6-4-5-7-20)27(37)30(2)18-42-30/h6,8-11,19,23,25-26,36H,4-5,7,12-18H2,1-3H3,(H,31,35)(H,32,39)(H,33,38)/t19-,23-,25-,26+,30+/m0/s1 |
| InChIKey | GHYOCDFICYLMRF-UTIIJYGPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zetomipzomib (CHEBI:756954) has role anti-anaemic agent (CHEBI:75835) |
| zetomipzomib (CHEBI:756954) has role anti-inflammatory agent (CHEBI:67079) |
| zetomipzomib (CHEBI:756954) has role antineoplastic agent (CHEBI:35610) |
| zetomipzomib (CHEBI:756954) has role antiviral agent (CHEBI:22587) |
| zetomipzomib (CHEBI:756954) is a oligopeptide (CHEBI:25676) |
| INN | Source |
|---|---|
| zetomipzomib | WHO MedNet |
| Synonym | Source |
|---|---|
| KZR-616 | ChEMBL |
| Citations |
|---|