EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H29F3N4O3 |
| Net Charge | 0 |
| Average Mass | 610.636 |
| Monoisotopic Mass | 610.21918 |
| SMILES | Nc1ccc(/C=C/C(=O)NCc2cc3cc(-c4ccc(C(=O)N5CCC(F)(F)CC5)cc4)cc(-c4ccc(F)cc4)c3o2)cn1 |
| InChI | InChI=1S/C35H29F3N4O3/c36-28-9-7-24(8-10-28)30-19-26(23-3-5-25(6-4-23)34(44)42-15-13-35(37,38)14-16-42)17-27-18-29(45-33(27)30)21-41-32(43)12-2-22-1-11-31(39)40-20-22/h1-12,17-20H,13-16,21H2,(H2,39,40)(H,41,43)/b12-2+ |
| InChIKey | MRFOPLWJZULAQD-SWGQDTFXSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| padnarsertib (CHEBI:756953) has role antineoplastic agent (CHEBI:35610) |
| padnarsertib (CHEBI:756953) is a benzofurans (CHEBI:35259) |
| INN | Source |
|---|---|
| padnarsertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Kpt 9274 | ChEMBL |
| KPT-9274 | ChEMBL |
| Pak4-in-1 | ChEMBL |
| Citations |
|---|