EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33F3N4O3 |
| Net Charge | 0 |
| Average Mass | 518.580 |
| Monoisotopic Mass | 518.25048 |
| SMILES | COc1cc(C)nc(=O)c1CNC(=O)c1c(C)n([C@H](C)C2CCN(CC(F)(F)F)CC2)c2ccccc12 |
| InChI | InChI=1S/C27H33F3N4O3/c1-16-13-23(37-4)21(25(35)32-16)14-31-26(36)24-18(3)34(22-8-6-5-7-20(22)24)17(2)19-9-11-33(12-10-19)15-27(28,29)30/h5-8,13,17,19H,9-12,14-15H2,1-4H3,(H,31,36)(H,32,35)/t17-/m1/s1 |
| InChIKey | HPODOLXTMDHLLC-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cpi-1205 (CHEBI:756949) has role antineoplastic agent (CHEBI:35610) |
| cpi-1205 (CHEBI:756949) is a indolecarboxamide (CHEBI:46921) |
| INN | Source |
|---|---|
| lirametostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| CPI-1205 | ChEMBL |
| Ezh2 inhibitor cpi-1205 | ChEMBL |
| Citations |
|---|