EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N4O3 |
| Net Charge | 0 |
| Average Mass | 418.497 |
| Monoisotopic Mass | 418.20049 |
| SMILES | COc1cccc2nc3c4c(c5c(c3c12)C(=O)N(CN1CCN(C)CC1)C5=O)CCC4 |
| InChI | InChI=1S/C24H26N4O3/c1-26-9-11-27(12-10-26)13-28-23(29)18-14-5-3-6-15(14)22-20(21(18)24(28)30)19-16(25-22)7-4-8-17(19)31-2/h4,7-8,25H,3,5-6,9-13H2,1-2H3 |
| InChIKey | CTLOSZHDGZLOQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cep-9722 (CHEBI:756947) has role antineoplastic agent (CHEBI:35610) |
| cep-9722 (CHEBI:756947) is a organic heterotetracyclic compound (CHEBI:38163) |
| cep-9722 (CHEBI:756947) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Synonyms | Source |
|---|---|
| Cep 9722 | ChEMBL |
| CEP-9722 | ChEMBL |
| Citations |
|---|