EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N2O6S |
| Net Charge | 0 |
| Average Mass | 472.563 |
| Monoisotopic Mass | 472.16681 |
| SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)N2Cc3cccc(NC(=O)C4CC4)c3C2=O)ccc1OC |
| InChI | InChI=1S/C24H28N2O6S/c1-4-32-21-12-16(10-11-20(21)31-2)19(14-33(3,29)30)26-13-17-6-5-7-18(22(17)24(26)28)25-23(27)15-8-9-15/h5-7,10-12,15,19H,4,8-9,13-14H2,1-3H3,(H,25,27)/t19-/m1/s1 |
| InChIKey | QDZOBXFRIVOQBR-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dovramilast (CHEBI:756946) has role antitubercular agent (CHEBI:33231) |
| dovramilast (CHEBI:756946) is a isoindoles (CHEBI:24897) |
| INN | Source |
|---|---|
| dovramilast | WHO MedNet |
| Synonyms | Source |
|---|---|
| CC-11050 | ChEMBL |
| CC11050 | ChEMBL |