EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H33N5O2 |
| Net Charge | 0 |
| Average Mass | 495.627 |
| Monoisotopic Mass | 495.26343 |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(C(C)(C)O)cc3n([C@H](c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C30H33N5O2/c1-19-28(34(4)33-32-19)22-16-26-27(31-18-22)24-11-10-23(30(2,3)36)17-25(24)35(26)29(20-8-6-5-7-9-20)21-12-14-37-15-13-21/h5-11,16-18,21,29,36H,12-15H2,1-4H3/t29-/m1/s1 |
| InChIKey | KGERZPVQIRYWRK-GDLZYMKVSA-N |
| Roles Classification |
|---|
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ezobresib (CHEBI:756944) has role antifibrotic agent (CHEBI:233423) |
| ezobresib (CHEBI:756944) has role antineoplastic agent (CHEBI:35610) |
| ezobresib (CHEBI:756944) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| ezobresib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bet inhibitor bms-986158 | ChEMBL |
| BMS-986158 | ChEMBL |
| Citations |
|---|