EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C18H18ClN3O |
| Net Charge | 0 |
| Average Mass | 364.276 |
| Monoisotopic Mass | 363.09052 |
| SMILES | CC(C)(O)c1cccn2c(C3(c4ccc(Cl)cc4)CC3)nnc12.Cl |
| InChI | InChI=1S/C18H18ClN3O.ClH/c1-17(2,23)14-4-3-11-22-15(14)20-21-16(22)18(9-10-18)12-5-7-13(19)8-6-12;/h3-8,11,23H,9-10H2,1-2H3;1H |
| InChIKey | MQBBSMNIRWXALO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-823778 (CHEBI:756943) has role antihypertensive agent (CHEBI:35674) |
| bms-823778 (CHEBI:756943) has role cardiovascular drug (CHEBI:35554) |
| bms-823778 (CHEBI:756943) has role hypoglycemic agent (CHEBI:35526) |
| bms-823778 (CHEBI:756943) is a triazolopyridine (CHEBI:46746) |
| Synonym | Source |
|---|---|
| BMS-823778 | ChEMBL |
| Citations |
|---|