EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35N9O8S |
| Net Charge | 0 |
| Average Mass | 597.655 |
| Monoisotopic Mass | 597.23293 |
| SMILES | CC(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(N)=O |
| InChI | InChI=1S/C23H35N9O8S/c1-11(34)32-4-2-3-17(32)23(40)29-14(5-12-7-26-10-27-12)20(37)30-15(8-33)21(38)31-16(9-41)22(39)28-13(19(25)36)6-18(24)35/h7,10,13-17,33,41H,2-6,8-9H2,1H3,(H2,24,35)(H2,25,36)(H,26,27)(H,28,39)(H,29,40)(H,30,37)(H,31,38)/t13-,14-,15-,16-,17-/m0/s1 |
| InChIKey | MMHDBUJXLOFTLC-WOYTXXSLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atn-161 (CHEBI:756942) has role antineoplastic agent (CHEBI:35610) |
| atn-161 (CHEBI:756942) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| Ac-phscn-nh2 | ChEMBL |
| ATN 161 | ChEMBL |
| ATN-161 | ChEMBL |