EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10F3N5O3S |
| Net Charge | 0 |
| Average Mass | 421.360 |
| Monoisotopic Mass | 421.04564 |
| SMILES | O=C(O)Cc1nn(Cc2nc3cc(C(F)(F)F)ccc3s2)c(=O)c2nccnc12 |
| InChI | InChI=1S/C17H10F3N5O3S/c18-17(19,20)8-1-2-11-9(5-8)23-12(29-11)7-25-16(28)15-14(21-3-4-22-15)10(24-25)6-13(26)27/h1-5H,6-7H2,(H,26,27) |
| InChIKey | YRGPAXAVTDMKDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caficrestat (CHEBI:756941) has role antiviral agent (CHEBI:22587) |
| caficrestat (CHEBI:756941) is a benzothiazoles (CHEBI:37947) |
| INN | Source |
|---|---|
| caficrestat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aldose reductase-in-1 | ChEMBL |
| At 001 | ChEMBL |
| AT-001 | ChEMBL |