EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30FN3O4 |
| Net Charge | 0 |
| Average Mass | 491.563 |
| Monoisotopic Mass | 491.22203 |
| SMILES | CCNC(=O)c1cc2c(-c3cc(C(C)(C)O)ccc3Oc3c(C)cc(F)cc3C)cn(C)c(=O)c2n1 |
| InChI | InChI=1S/C28H30FN3O4/c1-7-30-26(33)22-13-20-21(14-32(6)27(34)24(20)31-22)19-12-17(28(4,5)35)8-9-23(19)36-25-15(2)10-18(29)11-16(25)3/h8-14,31,35H,7H2,1-6H3,(H,30,33) |
| InChIKey | OEDSFMUSNZDJFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abbv-744 (CHEBI:756940) has role antifibrotic agent (CHEBI:233423) |
| abbv-744 (CHEBI:756940) has role antineoplastic agent (CHEBI:35610) |
| abbv-744 (CHEBI:756940) is a aromatic ether (CHEBI:35618) |
| Synonym | Source |
|---|---|
| ABBV-744 | ChEMBL |
| Citations |
|---|