EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34N6O |
| Net Charge | 0 |
| Average Mass | 422.577 |
| Monoisotopic Mass | 422.27941 |
| SMILES | CC(C)N1CCC(N2CCCN(c3cccc(C(=O)Nc4ccncc4)n3)CC2)CC1 |
| InChI | InChI=1S/C24H34N6O/c1-19(2)28-15-9-21(10-16-28)29-13-4-14-30(18-17-29)23-6-3-5-22(27-23)24(31)26-20-7-11-25-12-8-20/h3,5-8,11-12,19,21H,4,9-10,13-18H2,1-2H3,(H,25,26,31) |
| InChIKey | XNUNVQKARNSSEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| usl-311 (CHEBI:756937) has role antineoplastic agent (CHEBI:35610) |
| usl-311 (CHEBI:756937) is a aromatic carboxylic acid (CHEBI:33859) |
| usl-311 (CHEBI:756937) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| Usl 311 | ChEMBL |
| Usl-311 | ChEMBL |
| USL311 | ChEMBL |