EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21N7 |
| Net Charge | 0 |
| Average Mass | 395.470 |
| Monoisotopic Mass | 395.18584 |
| SMILES | c1ccc(-c2cc(-c3ccncc3)c(N3CCN(c4ncccn4)CC3)nn2)cc1 |
| InChI | InChI=1S/C23H21N7/c1-2-5-19(6-3-1)21-17-20(18-7-11-24-12-8-18)22(28-27-21)29-13-15-30(16-14-29)23-25-9-4-10-26-23/h1-12,17H,13-16H2 |
| InChIKey | ZPJGUEPHFXPAQF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tt-301 (CHEBI:756936) has role neuroprotective agent (CHEBI:63726) |
| tt-301 (CHEBI:756936) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| MW-01-6-189WH | ChEMBL |
| MW01-6-189WH | ChEMBL |
| MW-189 | ChEMBL |
| Tt-301 | ChEMBL |
| TT301 | ChEMBL |