EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756935 - trv-120027
| Formula | C43H67N13O10 |
| Net Charge | 0 |
| Average Mass | 926.090 |
| Monoisotopic Mass | 925.51339 |
| SMILES | [H][C@@](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC)C(C)C)(C(=O)N[C@@H](Cc1cncn1)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C43H67N13O10/c1-7-24(4)35(40(63)53-31(19-27-20-47-22-49-27)41(64)56-17-9-11-32(56)38(61)50-25(5)42(65)66)55-37(60)30(18-26-12-14-28(57)15-13-26)52-39(62)34(23(2)3)54-36(59)29(51-33(58)21-46-6)10-8-16-48-43(44)45/h12-15,20,22-25,29-32,34-35,46,57H,7-11,16-19,21H2,1-6H3,(H,47,49)(H,50,61)(H,51,58)(H,52,62)(H,53,63)(H,54,59)(H,55,60)(H,65,66)(H4,44,45,48)/t24-,25+,29-,30-,31-,32-,34-,35-/m0/s1 |
| InChIKey | XIEWFECSPPTVQN-KMIMAYJXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trv-120027 (CHEBI:756935) has role antiviral agent (CHEBI:22587) |
| trv-120027 (CHEBI:756935) has role cardiovascular drug (CHEBI:35554) |
| trv-120027 (CHEBI:756935) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| Sar-val-tyr-ile-his-pro-d-ala-oh | ChEMBL |
| TRV 027 | ChEMBL |
| TRV-027 | ChEMBL |
| TRV027 | ChEMBL |
| Trv-120027 | ChEMBL |
| Trv120027 | ChEMBL |