EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31O14 |
| Net Charge | +1 |
| Average Mass | 639.586 |
| Monoisotopic Mass | 639.17083 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2O[C@H](COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C32H30O14/c1-41-22-9-16(10-23(42-2)27(22)37)31-24(13-19-20(35)11-18(34)12-21(19)44-31)45-32-30(40)29(39)28(38)25(46-32)14-43-26(36)8-5-15-3-6-17(33)7-4-15/h3-13,25,28-30,32,38-40H,14H2,1-2H3,(H3-,33,34,35,36,37)/p+1/t25-,28-,29+,30-,32-/m1/s1 |
| InChIKey | HXQOVGDXCHFLOP-KWNZYCHBSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) has functional parent malvidin (CHEBI:6674) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) has role metabolite (CHEBI:25212) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) is a anthocyanin cation (CHEBI:35218) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) is a aromatic ether (CHEBI:35618) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) is a cinnamate ester (CHEBI:36087) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) is a polyphenol (CHEBI:26195) |
| malvidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75693) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenium-3-yl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Malvidin 3-(6''-p-coumarylglucoside) | LIPID MAPS |
| malvidin-3-O-(6-O-trans-p-coumaryl-β-D-glucoside) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12010383 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9605442 | Reaxys |