EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O |
| Net Charge | 0 |
| Average Mass | 236.274 |
| Monoisotopic Mass | 236.09496 |
| SMILES | O=C1N=C2C=CC=CN2C12Cc1ccccc1C2 |
| InChI | InChI=1S/C15H12N2O/c18-14-15(17-8-4-3-7-13(17)16-14)9-11-5-1-2-6-12(11)10-15/h1-8H,9-10H2 |
| InChIKey | QZWYXEBIQWJXAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ismidenon (CHEBI:756925) has role antineoplastic agent (CHEBI:35610) |
| ismidenon (CHEBI:756925) is a imidazopyridine (CHEBI:46908) |
| INN | Source |
|---|---|
| ismidenon | WHO MedNet |
| Synonyms | Source |
|---|---|
| AD-101 | ChEMBL |
| AD101 | ChEMBL |
| St-101 | ChEMBL |
| ST101 | ChEMBL |
| ZSET-1446 | ChEMBL |