EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36N2O6 |
| Net Charge | 0 |
| Average Mass | 556.659 |
| Monoisotopic Mass | 556.25734 |
| SMILES | O=C(O)CN1C(=O)[C@@H](NC(=O)C2(C[C@@H](CCc3cccc4ccccc34)C(=O)O)CCCC2)CCc2ccccc21 |
| InChI | InChI=1S/C33H36N2O6/c36-29(37)21-35-28-13-4-2-9-24(28)16-17-27(30(35)38)34-32(41)33(18-5-6-19-33)20-25(31(39)40)15-14-23-11-7-10-22-8-1-3-12-26(22)23/h1-4,7-13,25,27H,5-6,14-21H2,(H,34,41)(H,36,37)(H,39,40)/t25-,27+/m1/s1 |
| InChIKey | LOFDNSDPZTVIIO-VPUSJEBWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| slv-334 (CHEBI:756920) has role neuroprotective agent (CHEBI:63726) |
| slv-334 (CHEBI:756920) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Slv-334 | ChEMBL |
| SLV334 | ChEMBL |