EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC/C=C\C[C@@H]1O[C@H]1/C=C/[C@H](O)C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-10-13-18-19(24-18)16-15-17(21)12-9-7-8-11-14-20(22)23/h6-7,9-10,15-19,21H,2-5,8,11-14H2,1H3,(H,22,23)/b9-7-,10-6-,16-15+/t17-,18+,19+/m1/s1 |
| InChIKey | SGTUOBURCVMACZ-MEVKQHDMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,9E,14Z)-trienoic acid (CHEBI:75692) has functional parent (5Z,9E,14Z)-icosa-5,9,14-trienoic acid (CHEBI:36037) |
| (8R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,9E,14Z)-trienoic acid (CHEBI:75692) is a epoxy(hydroxy)icosatrienoic acid (CHEBI:138138) |
| (8R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,9E,14Z)-trienoic acid (CHEBI:75692) is conjugate acid of (8R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,9E,14Z)-trienoate (CHEBI:75233) |
| Incoming Relation(s) |
| (8R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,9E,14Z)-trienoate (CHEBI:75233) is conjugate base of (8R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,9E,14Z)-trienoic acid (CHEBI:75692) |
| IUPAC Name |
|---|
| (5Z,8R,9E)-8-hydroxy-10-{(2S,3S)-3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}deca-5,9-dienoic acid |
| Synonym | Source |
|---|---|
| (8R)-hydroxy-(11S,12S)-epoxyeicosa-(5Z,9E,14Z)-trienoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3594945 | Reaxys |
| Citations |
|---|