EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24ClFO7 |
| Net Charge | 0 |
| Average Mass | 454.878 |
| Monoisotopic Mass | 454.11946 |
| SMILES | CCOc1ccc(Cc2cc([C@@]34OC[C@@](CO)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1F |
| InChI | InChI=1S/C22H24ClFO7/c1-2-29-17-6-3-12(8-16(17)24)7-13-9-14(4-5-15(13)23)22-20(28)18(26)19(27)21(10-25,31-22)11-30-22/h3-6,8-9,18-20,25-28H,2,7,10-11H2,1H3/t18-,19-,20+,21+,22+/m0/s1 |
| InChIKey | HYTPDMFFHVZBOR-VNXMGFANSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| henagliflozin (CHEBI:756919) has role anti-arrhythmia drug (CHEBI:38070) |
| henagliflozin (CHEBI:756919) has role hypoglycemic agent (CHEBI:35526) |
| henagliflozin (CHEBI:756919) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Henagliflozin | ChEMBL |
| SHR-3824 | ChEMBL |
| SHR3824 | ChEMBL |