EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16N2O5S |
| Net Charge | 0 |
| Average Mass | 420.446 |
| Monoisotopic Mass | 420.07799 |
| SMILES | O=C(Nc1nc(-c2ccc(O)c(O)c2)c(-c2ccccc2)s1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H16N2O5S/c25-15-8-6-13(10-17(15)27)19-20(12-4-2-1-3-5-12)30-22(23-19)24-21(29)14-7-9-16(26)18(28)11-14/h1-11,25-28H,(H,23,24,29) |
| InChIKey | LGGDLPSXAGQFSG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coh-29 (CHEBI:756910) has role antineoplastic agent (CHEBI:35610) |
| coh-29 (CHEBI:756910) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Coh-29 | ChEMBL |
| COH29 | ChEMBL |
| Rnr inhibitor coh29 | ChEMBL |