EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10F20 |
| Net Charge | 0 |
| Average Mass | 500.070 |
| Monoisotopic Mass | 499.96806 |
| SMILES | FC(F)(F)C(C(F)(F)F)(C(F)(F)F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F20/c11-2(1(8(22,23)24,9(25,26)27)10(28,29)30)3(12,13)5(16,17)7(20,21)6(18,19)4(2,14)15 |
| InChIKey | VLTXBOGHSBHSAC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluoro tert-butylcyclohexane (CHEBI:756902) has role neuroprotective agent (CHEBI:63726) |
| perfluoro tert-butylcyclohexane (CHEBI:756902) is a alicyclic compound (CHEBI:33654) |
| perfluoro tert-butylcyclohexane (CHEBI:756902) is a organohalogen compound (CHEBI:17792) |
| Synonyms | Source |
|---|---|
| Oxycyte | ChEMBL |
| Perfluoro t-butylcyclohexane | ChEMBL |
| Perfluoro tert-butylcyclohexane | ChEMBL |