EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H68O11 |
| Net Charge | 0 |
| Average Mass | 724.973 |
| Monoisotopic Mass | 724.47616 |
| SMILES | [H][C@]1(C[C@@H]2C[C@@H](OC)[C@@H](C)[C@]3(O2)O[C@](C)([C@@]2([H])CC[C@@](C)([C@]4([H])O[C@@]([H])([C@@]5([H])O[C@@](O)(CO)[C@H](C)C[C@@H]5C)C[C@@H]4C)O2)C[C@H]3C)CC[C@H](C)[C@]([H])([C@@H](C)C(=O)O)O1 |
| InChI | InChI=1S/C40H68O11/c1-21-11-12-28(46-33(21)26(6)36(42)43)17-29-18-30(45-10)27(7)40(48-29)25(5)19-38(9,51-40)32-13-14-37(8,49-32)35-23(3)16-31(47-35)34-22(2)15-24(4)39(44,20-41)50-34/h21-35,41,44H,11-20H2,1-10H3,(H,42,43)/t21-,22-,23-,24+,25+,26+,27+,28+,29+,30+,31+,32+,33+,34-,35+,37-,38-,39-,40+/m0/s1 |
| InChIKey | DANUORFCFTYTSZ-SJSJOXFOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. potassium ionophore Any ionophore capable of transportation of potassium ions across membranes. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigericin (CHEBI:7569) has role antibacterial agent (CHEBI:33282) |
| nigericin (CHEBI:7569) has role antimicrobial agent (CHEBI:33281) |
| nigericin (CHEBI:7569) has role bacterial metabolite (CHEBI:76969) |
| nigericin (CHEBI:7569) has role potassium ionophore (CHEBI:88227) |
| nigericin (CHEBI:7569) is a polycyclic ether (CHEBI:36468) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,3S,6R)-6-{[(2S,4R,5R,7R,9R,10R)-2-{(2S,2'R,3'S,5R,5'R)-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-2,3'-dimethyloctahydro-2,2'-bifuran-5-yl}-9-methoxy-2,4,10-trimethyl-1,6-dioxaspiro[4.5]dec-7-yl]methyl}-3-methyltetrahydro-2H-pyran-2-yl]propanoic acid |
| Synonyms | Source |
|---|---|
| Azalomycin M | ChemIDplus |
| Helixin C | ChemIDplus |
| Polyetherin A | ChemIDplus |
| Citations |
|---|