EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H68O11 |
| Net Charge | 0 |
| Average Mass | 724.973 |
| Monoisotopic Mass | 724.47616 |
| SMILES | [H][C@]1(C[C@@H]2C[C@@H](OC)[C@@H](C)[C@]3(O2)O[C@](C)([C@@]2([H])CC[C@@](C)([C@]4([H])O[C@@]([H])([C@@]5([H])O[C@@](O)(CO)[C@H](C)C[C@@H]5C)C[C@@H]4C)O2)C[C@H]3C)CC[C@H](C)[C@]([H])([C@@H](C)C(=O)O)O1 |
| InChI | InChI=1S/C40H68O11/c1-21-11-12-28(46-33(21)26(6)36(42)43)17-29-18-30(45-10)27(7)40(48-29)25(5)19-38(9,51-40)32-13-14-37(8,49-32)35-23(3)16-31(47-35)34-22(2)15-24(4)39(44,20-41)50-34/h21-35,41,44H,11-20H2,1-10H3,(H,42,43)/t21-,22-,23-,24+,25+,26+,27+,28+,29+,30+,31+,32+,33+,34-,35+,37-,38-,39-,40+/m0/s1 |
| InChIKey | DANUORFCFTYTSZ-SJSJOXFOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. potassium ionophore Any ionophore capable of transportation of potassium ions across membranes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigericin (CHEBI:7569) has role antibacterial agent (CHEBI:33282) |
| nigericin (CHEBI:7569) has role antimicrobial agent (CHEBI:33281) |
| nigericin (CHEBI:7569) has role bacterial metabolite (CHEBI:76969) |
| nigericin (CHEBI:7569) has role potassium ionophore (CHEBI:88227) |
| nigericin (CHEBI:7569) is a polycyclic ether (CHEBI:36468) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,3S,6R)-6-{[(2S,4R,5R,7R,9R,10R)-2-{(2S,2'R,3'S,5R,5'R)-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-2,3'-dimethyloctahydro-2,2'-bifuran-5-yl}-9-methoxy-2,4,10-trimethyl-1,6-dioxaspiro[4.5]dec-7-yl]methyl}-3-methyltetrahydro-2H-pyran-2-yl]propanoic acid |
| Synonyms | Source |
|---|---|
| Helixin C | ChemIDplus |
| Azalomycin M | ChemIDplus |
| Polyetherin A | ChemIDplus |
| Citations |
|---|