EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20F3N5O5S2 |
| Net Charge | 0 |
| Average Mass | 519.527 |
| Monoisotopic Mass | 519.08580 |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccnc3cc(-c4cccc(SC(F)(F)F)c4)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H20F3N5O5S2/c20-19(21,22)33-12-3-1-2-10(6-12)13-8-16-24-5-4-15(27(16)26-13)25-14-7-11(17(28)18(14)29)9-32-34(23,30)31/h1-6,8,11,14,17-18,25,28-29H,7,9H2,(H2,23,30,31)/t11-,14-,17-,18+/m1/s1 |
| InChIKey | KJDAGXLMHXUAGV-DGWLBADLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tak-243 (CHEBI:756894) has role antineoplastic agent (CHEBI:35610) |
| tak-243 (CHEBI:756894) is a pyrazoles (CHEBI:26410) |
| tak-243 (CHEBI:756894) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| MLN-7243 | ChEMBL |
| MLN7243 | ChEMBL |
| Tak 243 | ChEMBL |
| Tak-243 | ChEMBL |
| Uae inhibitor mln7243 | ChEMBL |