EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C24H30Cl2FN3O3 |
| Net Charge | 0 |
| Average Mass | 534.887 |
| Monoisotopic Mass | 533.14150 |
| SMILES | CCOC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)[C@@H](N)Cc1ccc(N(CCCl)CCCl)cc1.Cl |
| InChI | InChI=1S/C24H30Cl2FN3O3.ClH/c1-2-33-24(32)22(16-18-3-7-19(27)8-4-18)29-23(31)21(28)15-17-5-9-20(10-6-17)30(13-11-25)14-12-26;/h3-10,21-22H,2,11-16,28H2,1H3,(H,29,31);1H/t21-,22-;/m0./s1 |
| InChIKey | ZCMWSKHHXLCVHI-VROPFNGYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| melphalan flufenamide hydrochloride (CHEBI:756892) has role antineoplastic agent (CHEBI:35610) |
| melphalan flufenamide hydrochloride (CHEBI:756892) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| CK 1535 | ChEMBL |
| CK-1535 | ChEMBL |
| J1 hydrochloride | ChEMBL |
| J-1 HYDROCHLORIDE | ChEMBL |
| Melflufen | ChEMBL |
| Melflufen hydrochloride | ChEMBL |
| Brand Names | Source |
|---|---|
| Pepaxti | ChEMBL |
| Pepaxto | ChEMBL |