EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22N10O3 |
| Net Charge | 0 |
| Average Mass | 510.518 |
| Monoisotopic Mass | 510.18763 |
| SMILES | Cc1nnnn1N=Cc1ccc(O)c(C(c2ccc(O)cc2)c2cc(C=Nn3nnnc3C)ccc2O)c1 |
| InChI | InChI=1S/C25H22N10O3/c1-15-28-30-32-34(15)26-13-17-3-9-23(37)21(11-17)25(19-5-7-20(36)8-6-19)22-12-18(4-10-24(22)38)14-27-35-16(2)29-31-33-35/h3-14,25,36-38H,1-2H3 |
| InChIKey | BLUJRJMLDHEMRX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vp-14637 (CHEBI:756891) has role antiviral agent (CHEBI:22587) |
| vp-14637 (CHEBI:756891) is a benzenoid aromatic compound (CHEBI:33836) |
| Synonyms | Source |
|---|---|
| Mdt-637 | ChEMBL |
| Vp-14637 | ChEMBL |