EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37N4O7PS |
| Net Charge | 0 |
| Average Mass | 556.622 |
| Monoisotopic Mass | 556.21206 |
| SMILES | CCOC(=O)C(C)(C)NP(=O)(NC(C)(C)C(=O)OCC)c1ccc(-c2nc(N)sc2C(=O)C(C)(C)C)o1 |
| InChI | InChI=1S/C24H37N4O7PS/c1-10-33-19(30)23(6,7)27-36(32,28-24(8,9)20(31)34-11-2)15-13-12-14(35-15)16-17(37-21(25)26-16)18(29)22(3,4)5/h12-13H,10-11H2,1-9H3,(H2,25,26)(H2,27,28,32) |
| InChIKey | CTKZZUXRWBCFEI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mb-07803 (CHEBI:756889) has role hypoglycemic agent (CHEBI:35526) |
| mb-07803 (CHEBI:756889) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Mb-07803 | ChEMBL |
| Mb07803 | ChEMBL |
| MB 07803 | ChEMBL |