EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO6 |
| Net Charge | 0 |
| Average Mass | 473.610 |
| Monoisotopic Mass | 473.27774 |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2cc(C)on2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)/C=C\C1 |
| InChI | InChI=1S/C27H39NO6/c1-16-9-8-10-17(2)25(31)20(5)26(32)27(6,7)23(29)15-24(30)33-22(12-11-16)18(3)13-21-14-19(4)34-28-21/h8,10-11,13-14,17,20,22-23,25,29,31H,9,12,15H2,1-7H3/b10-8-,16-11-,18-13+/t17-,20+,22-,23-,25-/m0/s1 |
| InChIKey | JAYGOFBXDFAXBW-CYEKYUJNSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kosn-1724 (CHEBI:756884) has role antineoplastic agent (CHEBI:35610) |
| kosn-1724 (CHEBI:756884) is a isoxazoles (CHEBI:55373) |
| Synonyms | Source |
|---|---|
| Iso-fludelone | ChEMBL |
| Kosn-1724 | ChEMBL |